C7H14F2 — CID 174248486
(2R,3S)-1,2-difluoro-3,4-dimethylpentane (PubChem CID 174248486) has the molecular formula C7H14F2 and a molecular weight of 136.18 g/mol. Its IUPAC name is (2R,3S)-1,2-difluoro-3,4-dimethylpentane.
| Compound Name | (2R,3S)-1,2-difluoro-3,4-dimethylpentane |
|---|---|
| PubChem CID | 174248486 |
| Molecular Formula | C7H14F2 |
| Molecular Weight | 136.18 g/mol |
| Exact Mass | 136.11 |
| IUPAC Name | (2R,3S)-1,2-difluoro-3,4-dimethylpentane |
| SMILES | CC(C)[C@H](C)[C@@H](F)CF |
| InChI | InChI=1S/C7H14F2/c1-5(2)6(3)7(9)4-8/h5-7H,4H2,1-3H3/t6-,7-/m0/s1 |
| InChIKey | IRIVTFCRHCOOAJ-BQBZGAKWSA-N |
| XLogP | 2.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.18 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |