C7H15F — CID 163563398
(2R,3R)-2-fluoro-3,4-dimethylpentane (PubChem CID 163563398) has the molecular formula C7H15F and a molecular weight of 118.20 g/mol. Its IUPAC name is (2R,3R)-2-fluoro-3,4-dimethylpentane.
| Compound Name | (2R,3R)-2-fluoro-3,4-dimethylpentane |
|---|---|
| PubChem CID | 163563398 |
| Molecular Formula | C7H15F |
| Molecular Weight | 118.20 g/mol |
| Exact Mass | 118.12 |
| IUPAC Name | (2R,3R)-2-fluoro-3,4-dimethylpentane |
| SMILES | CC(C)[C@@H](C)[C@@H](C)F |
| InChI | InChI=1S/C7H15F/c1-5(2)6(3)7(4)8/h5-7H,1-4H3/t6-,7-/m1/s1 |
| InChIKey | FTEHLRGODYTDRS-RNFRBKRXSA-N |
| XLogP | 2.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.20 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |