C3H5F3 — CID 57131379
(2S)-1,1,2-trifluoropropane (PubChem CID 57131379) has the molecular formula C3H5F3 and a molecular weight of 98.07 g/mol. Its IUPAC name is (2S)-1,1,2-trifluoropropane.
| Compound Name | (2S)-1,1,2-trifluoropropane |
|---|---|
| PubChem CID | 57131379 |
| Molecular Formula | C3H5F3 |
| Molecular Weight | 98.07 g/mol |
| Exact Mass | 98.03 |
| IUPAC Name | (2S)-1,1,2-trifluoropropane |
| SMILES | C[C@H](F)C(F)F |
| InChI | InChI=1S/C3H5F3/c1-2(4)3(5)6/h2-3H,1H3/t2-/m0/s1 |
| InChIKey | HHRQYHKSSIGXJV-REOHCLBHSA-N |
| XLogP | 1.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 98.07 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |