About 1-fluoroethanol;rutherfordium
1-fluoroethanol;rutherfordium (PubChem CID 58987118) has the molecular formula C2H5FORf
and a molecular weight of 331.06 g/mol. Its IUPAC name is 1-fluoroethanol;rutherfordium.
Molecular Properties
| Compound Name | 1-fluoroethanol;rutherfordium |
| PubChem CID | 58987118 |
| Molecular Formula | C2H5FORf |
| Molecular Weight | 331.06 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 1-fluoroethanol;rutherfordium |
| SMILES | CC(O)F.[Rf] |
| InChI | InChI=1S/C2H5FO.Rf/c1-2(3)4;/h2,4H,1H3; |
| InChIKey | NERNJTODAPBEJY-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.06 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-fluoroethanol;rutherfordium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoroethanol;rutherfordium?
The IUPAC name of 1-fluoroethanol;rutherfordium (CID 58987118) is 1-fluoroethanol;rutherfordium.
What is the SMILES notation for 1-fluoroethanol;rutherfordium?
The canonical SMILES for 1-fluoroethanol;rutherfordium is CC(O)F.[Rf].
What is the InChIKey of 1-fluoroethanol;rutherfordium?
The InChIKey is NERNJTODAPBEJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5FO.Rf/c1-2(3)4;/h2,4H,1H3;.
What are the key properties of 1-fluoroethanol;rutherfordium?
1-fluoroethanol;rutherfordium has a molecular weight of 331.06 g/mol, XLogP of 0.29, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoroethanol;rutherfordium is sourced from PubChem (CID 58987118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).