C6H8F6 — CID 138705307
1,1,2,3,5,5-hexafluoro-4-methylpentane (PubChem CID 138705307) has the molecular formula C6H8F6 and a molecular weight of 194.12 g/mol. Its IUPAC name is 1,1,2,3,5,5-hexafluoro-4-methylpentane.
| Compound Name | 1,1,2,3,5,5-hexafluoro-4-methylpentane |
|---|---|
| PubChem CID | 138705307 |
| Molecular Formula | C6H8F6 |
| Molecular Weight | 194.12 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | 1,1,2,3,5,5-hexafluoro-4-methylpentane |
| SMILES | CC(C(F)F)C(F)C(F)C(F)F |
| InChI | InChI=1S/C6H8F6/c1-2(5(9)10)3(7)4(8)6(11)12/h2-6H,1H3 |
| InChIKey | SAYZWPGPPLKLCH-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.12 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |