C6H13F3Si — CID 173293259
(1,1,2-trifluoro-4-methylpentan-3-yl)silane (PubChem CID 173293259) has the molecular formula C6H13F3Si and a molecular weight of 170.25 g/mol. Its IUPAC name is (1,1,2-trifluoro-4-methylpentan-3-yl)silane.
| Compound Name | (1,1,2-trifluoro-4-methylpentan-3-yl)silane |
|---|---|
| PubChem CID | 173293259 |
| Molecular Formula | C6H13F3Si |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | (1,1,2-trifluoro-4-methylpentan-3-yl)silane |
| SMILES | CC(C)C([SiH3])C(F)C(F)F |
| InChI | InChI=1S/C6H13F3Si/c1-3(2)5(10)4(7)6(8)9/h3-6H,1-2,10H3 |
| InChIKey | GAZMZEHJHVDDOK-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|