C8H17F2N — CID 162494430
1,1-difluoro-3-methyl-N-propan-2-ylbutan-2-amine (PubChem CID 162494430) has the molecular formula C8H17F2N and a molecular weight of 165.23 g/mol. Its IUPAC name is 1,1-difluoro-3-methyl-N-propan-2-ylbutan-2-amine.
| Compound Name | 1,1-difluoro-3-methyl-N-propan-2-ylbutan-2-amine |
|---|---|
| PubChem CID | 162494430 |
| Molecular Formula | C8H17F2N |
| Molecular Weight | 165.23 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 1,1-difluoro-3-methyl-N-propan-2-ylbutan-2-amine |
| SMILES | CC(C)NC(C(C)C)C(F)F |
| InChI | InChI=1S/C8H17F2N/c1-5(2)7(8(9)10)11-6(3)4/h5-8,11H,1-4H3 |
| InChIKey | NVVPRXKYQYWIMT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.23 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |