About CID 87569665
CID 87569665 (PubChem CID 87569665) has the molecular formula C6H15Li2N
and a molecular weight of 115.08 g/mol.
Molecular Properties
| Compound Name | CID 87569665 |
| PubChem CID | 87569665 |
| Molecular Formula | C6H15Li2N |
| Molecular Weight | 115.08 g/mol |
| Exact Mass | 115.15 |
| IUPAC Name | — |
| SMILES | CC(C)NC(C)C.[Li].[Li] |
| InChI | InChI=1S/C6H15N.2Li/c1-5(2)7-6(3)4;;/h5-7H,1-4H3;; |
| InChIKey | BVYPMVRNEYAGPF-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.08 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 87569665 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87569665?
The IUPAC name of CID 87569665 (CID 87569665) is not available.
What is the SMILES notation for CID 87569665?
The canonical SMILES for CID 87569665 is CC(C)NC(C)C.[Li].[Li].
What is the InChIKey of CID 87569665?
The InChIKey is BVYPMVRNEYAGPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.2Li/c1-5(2)7-6(3)4;;/h5-7H,1-4H3;;.
What are the key properties of CID 87569665?
CID 87569665 has a molecular weight of 115.08 g/mol, XLogP of 0.63, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87569665 is sourced from PubChem (CID 87569665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).