About bis(1,4-dioxane);N-propan-2-ylpropan-2-amine
bis(1,4-dioxane);N-propan-2-ylpropan-2-amine (PubChem CID 158831625) has the molecular formula C14H31NO4
and a molecular weight of 277.40 g/mol. Its IUPAC name is bis(1,4-dioxane);N-propan-2-ylpropan-2-amine.
Molecular Properties
| Compound Name | bis(1,4-dioxane);N-propan-2-ylpropan-2-amine |
| PubChem CID | 158831625 |
| Molecular Formula | C14H31NO4 |
| Molecular Weight | 277.40 g/mol |
| Exact Mass | 277.23 |
| IUPAC Name | bis(1,4-dioxane);N-propan-2-ylpropan-2-amine |
| SMILES | C1COCCO1.C1COCCO1.CC(C)NC(C)C |
| InChI | InChI=1S/C6H15N.2C4H8O2/c1-5(2)7-6(3)4;2*1-2-6-4-3-5-1/h5-7H,1-4H3;2*1-4H2 |
| InChIKey | IXCQAUKAMQWVST-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.40 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze bis(1,4-dioxane);N-propan-2-ylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1,4-dioxane);N-propan-2-ylpropan-2-amine?
The IUPAC name of bis(1,4-dioxane);N-propan-2-ylpropan-2-amine (CID 158831625) is bis(1,4-dioxane);N-propan-2-ylpropan-2-amine.
What is the SMILES notation for bis(1,4-dioxane);N-propan-2-ylpropan-2-amine?
The canonical SMILES for bis(1,4-dioxane);N-propan-2-ylpropan-2-amine is C1COCCO1.C1COCCO1.CC(C)NC(C)C.
What is the InChIKey of bis(1,4-dioxane);N-propan-2-ylpropan-2-amine?
The InChIKey is IXCQAUKAMQWVST-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.2C4H8O2/c1-5(2)7-6(3)4;2*1-2-6-4-3-5-1/h5-7H,1-4H3;2*1-4H2.
What are the key properties of bis(1,4-dioxane);N-propan-2-ylpropan-2-amine?
bis(1,4-dioxane);N-propan-2-ylpropan-2-amine has a molecular weight of 277.40 g/mol, XLogP of 1.46, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1,4-dioxane);N-propan-2-ylpropan-2-amine is sourced from PubChem (CID 158831625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).