About oxirane;propan-2-amine
oxirane;propan-2-amine (PubChem CID 163631422) has the molecular formula C5H13NO
and a molecular weight of 103.16 g/mol. Its IUPAC name is oxirane;propan-2-amine.
Molecular Properties
| Compound Name | oxirane;propan-2-amine |
| PubChem CID | 163631422 |
| Molecular Formula | C5H13NO |
| Molecular Weight | 103.16 g/mol |
| Exact Mass | 103.10 |
| IUPAC Name | oxirane;propan-2-amine |
| SMILES | C1CO1.CC(C)N |
| InChI | InChI=1S/C3H9N.C2H4O/c1-3(2)4;1-2-3-1/h3H,4H2,1-2H3;1-2H2 |
| InChIKey | HWKHOTFUXMYSIU-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 38.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.16 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze oxirane;propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxirane;propan-2-amine?
The IUPAC name of oxirane;propan-2-amine (CID 163631422) is oxirane;propan-2-amine.
What is the SMILES notation for oxirane;propan-2-amine?
The canonical SMILES for oxirane;propan-2-amine is C1CO1.CC(C)N.
What is the InChIKey of oxirane;propan-2-amine?
The InChIKey is HWKHOTFUXMYSIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.C2H4O/c1-3(2)4;1-2-3-1/h3H,4H2,1-2H3;1-2H2.
What are the key properties of oxirane;propan-2-amine?
oxirane;propan-2-amine has a molecular weight of 103.16 g/mol, XLogP of 0.37, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for oxirane;propan-2-amine is sourced from PubChem (CID 163631422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).