About hydron;propan-2-amine
hydron;propan-2-amine (PubChem CID 174699722) has the molecular formula C3H10N+
and a molecular weight of 60.12 g/mol. Its IUPAC name is hydron;propan-2-amine.
Molecular Properties
| Compound Name | hydron;propan-2-amine |
| PubChem CID | 174699722 |
| Molecular Formula | C3H10N+ |
| Molecular Weight | 60.12 g/mol |
| Exact Mass | 60.08 |
| IUPAC Name | hydron;propan-2-amine |
| SMILES | CC(C)N.[H+] |
| InChI | InChI=1S/C3H9N/c1-3(2)4/h3H,4H2,1-2H3/p+1 |
| InChIKey | JJWLVOIRVHMVIS-UHFFFAOYSA-O |
| XLogP | 0.47 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 60.12 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze hydron;propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;propan-2-amine?
The IUPAC name of hydron;propan-2-amine (CID 174699722) is hydron;propan-2-amine.
What is the SMILES notation for hydron;propan-2-amine?
The canonical SMILES for hydron;propan-2-amine is CC(C)N.[H+].
What is the InChIKey of hydron;propan-2-amine?
The InChIKey is JJWLVOIRVHMVIS-UHFFFAOYSA-O. The full InChI is InChI=1S/C3H9N/c1-3(2)4/h3H,4H2,1-2H3/p+1.
What are the key properties of hydron;propan-2-amine?
hydron;propan-2-amine has a molecular weight of 60.12 g/mol, XLogP of 0.47, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;propan-2-amine is sourced from PubChem (CID 174699722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).