About ethane-1,1-diamine;tetrahydrochloride
ethane-1,1-diamine;tetrahydrochloride (PubChem CID 142050640) has the molecular formula C2H12Cl4N2
and a molecular weight of 205.94 g/mol. Its IUPAC name is ethane-1,1-diamine;tetrahydrochloride.
Molecular Properties
| Compound Name | ethane-1,1-diamine;tetrahydrochloride |
| PubChem CID | 142050640 |
| Molecular Formula | C2H12Cl4N2 |
| Molecular Weight | 205.94 g/mol |
| Exact Mass | 203.98 |
| IUPAC Name | ethane-1,1-diamine;tetrahydrochloride |
| SMILES | CC(N)N.Cl.Cl.Cl.Cl |
| InChI | InChI=1S/C2H8N2.4ClH/c1-2(3)4;;;;/h2H,3-4H2,1H3;4*1H |
| InChIKey | GLILURWLJBTTIZ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.94 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethane-1,1-diamine;tetrahydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane-1,1-diamine;tetrahydrochloride?
The IUPAC name of ethane-1,1-diamine;tetrahydrochloride (CID 142050640) is ethane-1,1-diamine;tetrahydrochloride.
What is the SMILES notation for ethane-1,1-diamine;tetrahydrochloride?
The canonical SMILES for ethane-1,1-diamine;tetrahydrochloride is CC(N)N.Cl.Cl.Cl.Cl.
What is the InChIKey of ethane-1,1-diamine;tetrahydrochloride?
The InChIKey is GLILURWLJBTTIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H8N2.4ClH/c1-2(3)4;;;;/h2H,3-4H2,1H3;4*1H.
What are the key properties of ethane-1,1-diamine;tetrahydrochloride?
ethane-1,1-diamine;tetrahydrochloride has a molecular weight of 205.94 g/mol, XLogP of 0.94, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane-1,1-diamine;tetrahydrochloride is sourced from PubChem (CID 142050640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).