C4H12N2 — CID 172719520
(3R)-butane-2,3-diamine (PubChem CID 172719520) has the molecular formula C4H12N2 and a molecular weight of 88.15 g/mol. Its IUPAC name is (3R)-butane-2,3-diamine.
| Compound Name | (3R)-butane-2,3-diamine |
|---|---|
| PubChem CID | 172719520 |
| Molecular Formula | C4H12N2 |
| Molecular Weight | 88.15 g/mol |
| Exact Mass | 88.10 |
| IUPAC Name | (3R)-butane-2,3-diamine |
| SMILES | CC(N)[C@@H](C)N |
| InChI | InChI=1S/C4H12N2/c1-3(5)4(2)6/h3-4H,5-6H2,1-2H3/t3-,4?/m1/s1 |
| InChIKey | GHWVXCQZPNWFRO-SYPWQXSBSA-N |
| XLogP | -0.32 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 88.15 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |