C9H27N7 — CID 58672678
nonane-2,3,4,5,6,7,8-heptamine (PubChem CID 58672678) has the molecular formula C9H27N7 and a molecular weight of 233.36 g/mol. Its IUPAC name is nonane-2,3,4,5,6,7,8-heptamine.
| Compound Name | nonane-2,3,4,5,6,7,8-heptamine |
|---|---|
| PubChem CID | 58672678 |
| Molecular Formula | C9H27N7 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.23 |
| IUPAC Name | nonane-2,3,4,5,6,7,8-heptamine |
| SMILES | CC(N)C(N)C(N)C(N)C(N)C(N)C(C)N |
| InChI | InChI=1S/C9H27N7/c1-3(10)5(12)7(14)9(16)8(15)6(13)4(2)11/h3-9H,10-16H2,1-2H3 |
| InChIKey | MMWOLAHNAMFZOM-UHFFFAOYSA-N |
| XLogP | -3.68 |
| TPSA | 182.14 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | -3.68 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |