C3H11N3 — CID 164890165
(2R)-propane-1,1,2-triamine (PubChem CID 164890165) has the molecular formula C3H11N3 and a molecular weight of 89.14 g/mol. Its IUPAC name is (2R)-propane-1,1,2-triamine.
| Compound Name | (2R)-propane-1,1,2-triamine |
|---|---|
| PubChem CID | 164890165 |
| Molecular Formula | C3H11N3 |
| Molecular Weight | 89.14 g/mol |
| Exact Mass | 89.10 |
| IUPAC Name | (2R)-propane-1,1,2-triamine |
| SMILES | C[C@@H](N)C(N)N |
| InChI | InChI=1S/C3H11N3/c1-2(4)3(5)6/h2-3H,4-6H2,1H3/t2-/m1/s1 |
| InChIKey | HTIMQENIYIHRMC-UWTATZPHSA-N |
| XLogP | -1.42 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 89.14 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|