About 1-aminoethanethiol;gold
1-aminoethanethiol;gold (PubChem CID 87377143) has the molecular formula C2H7AuNS
and a molecular weight of 274.12 g/mol. Its IUPAC name is 1-aminoethanethiol;gold.
Molecular Properties
| Compound Name | 1-aminoethanethiol;gold |
| PubChem CID | 87377143 |
| Molecular Formula | C2H7AuNS |
| Molecular Weight | 274.12 g/mol |
| Exact Mass | 274.00 |
| IUPAC Name | 1-aminoethanethiol;gold |
| SMILES | CC(N)S.[Au] |
| InChI | InChI=1S/C2H7NS.Au/c1-2(3)4;/h2,4H,3H2,1H3; |
| InChIKey | VEVIWNSEQUWQJJ-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.12 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-aminoethanethiol;gold with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminoethanethiol;gold?
The IUPAC name of 1-aminoethanethiol;gold (CID 87377143) is 1-aminoethanethiol;gold.
What is the SMILES notation for 1-aminoethanethiol;gold?
The canonical SMILES for 1-aminoethanethiol;gold is CC(N)S.[Au].
What is the InChIKey of 1-aminoethanethiol;gold?
The InChIKey is VEVIWNSEQUWQJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H7NS.Au/c1-2(3)4;/h2,4H,3H2,1H3;.
What are the key properties of 1-aminoethanethiol;gold?
1-aminoethanethiol;gold has a molecular weight of 274.12 g/mol, XLogP of 0.22, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminoethanethiol;gold is sourced from PubChem (CID 87377143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).