About ethane;pentane-2,3,4-triamine
ethane;pentane-2,3,4-triamine (PubChem CID 91203687) has the molecular formula C7H21N3
and a molecular weight of 147.27 g/mol. Its IUPAC name is ethane;pentane-2,3,4-triamine.
Molecular Properties
| Compound Name | ethane;pentane-2,3,4-triamine |
| PubChem CID | 91203687 |
| Molecular Formula | C7H21N3 |
| Molecular Weight | 147.27 g/mol |
| Exact Mass | 147.17 |
| IUPAC Name | ethane;pentane-2,3,4-triamine |
| SMILES | CC.CC(N)C(N)C(C)N |
| InChI | InChI=1S/C5H15N3.C2H6/c1-3(6)5(8)4(2)7;1-2/h3-5H,6-8H2,1-2H3;1-2H3 |
| InChIKey | SXNKBECCTYWDSV-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.27 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;pentane-2,3,4-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;pentane-2,3,4-triamine?
The IUPAC name of ethane;pentane-2,3,4-triamine (CID 91203687) is ethane;pentane-2,3,4-triamine.
What is the SMILES notation for ethane;pentane-2,3,4-triamine?
The canonical SMILES for ethane;pentane-2,3,4-triamine is CC.CC(N)C(N)C(C)N.
What is the InChIKey of ethane;pentane-2,3,4-triamine?
The InChIKey is SXNKBECCTYWDSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H15N3.C2H6/c1-3(6)5(8)4(2)7;1-2/h3-5H,6-8H2,1-2H3;1-2H3.
What are the key properties of ethane;pentane-2,3,4-triamine?
ethane;pentane-2,3,4-triamine has a molecular weight of 147.27 g/mol, XLogP of 0.03, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;pentane-2,3,4-triamine is sourced from PubChem (CID 91203687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).