C7H21N3 — CID 91203687
ethane;pentane-2,3,4-triamine (PubChem CID 91203687) has the molecular formula C7H21N3 and a molecular weight of 147.27 g/mol. Its IUPAC name is ethane;pentane-2,3,4-triamine.
| Compound Name | ethane;pentane-2,3,4-triamine |
|---|---|
| PubChem CID | 91203687 |
| Molecular Formula | C7H21N3 |
| Molecular Weight | 147.27 g/mol |
| Exact Mass | 147.17 |
| IUPAC Name | ethane;pentane-2,3,4-triamine |
| SMILES | CC.CC(N)C(N)C(C)N |
| InChI | InChI=1S/C5H15N3.C2H6/c1-3(6)5(8)4(2)7;1-2/h3-5H,6-8H2,1-2H3;1-2H3 |
| InChIKey | SXNKBECCTYWDSV-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.27 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |