C14H38 — CID 143330980
2,3-dimethylbutane;ethane (PubChem CID 143330980) has the molecular formula C14H38 and a molecular weight of 206.46 g/mol. Its IUPAC name is 2,3-dimethylbutane;ethane.
| Compound Name | 2,3-dimethylbutane;ethane |
|---|---|
| PubChem CID | 143330980 |
| Molecular Formula | C14H38 |
| Molecular Weight | 206.46 g/mol |
| Exact Mass | 206.30 |
| IUPAC Name | 2,3-dimethylbutane;ethane |
| SMILES | CC.CC.CC.CC.CC(C)C(C)C |
| InChI | InChI=1S/C6H14.4C2H6/c1-5(2)6(3)4;4*1-2/h5-6H,1-4H3;4*1-2H3 |
| InChIKey | LRQNUEGMAKCMDQ-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.46 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |