About ethane;methane;2-methylpropane
ethane;methane;2-methylpropane (PubChem CID 161431647) has the molecular formula C23H68
and a molecular weight of 344.80 g/mol. Its IUPAC name is ethane;methane;2-methylpropane.
Molecular Properties
| Compound Name | ethane;methane;2-methylpropane |
| PubChem CID | 161431647 |
| Molecular Formula | C23H68 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.53 |
| IUPAC Name | ethane;methane;2-methylpropane |
| SMILES | C.CC.CC.CC.CC.CC.CC.CC.CC.CC.CC(C)C |
| InChI | InChI=1S/C4H10.9C2H6.CH4/c1-4(2)3;9*1-2;/h4H,1-3H3;9*1-2H3;1H4 |
| InChIKey | VYCAXOYUYIYSDV-UHFFFAOYSA-N |
| XLogP | 11.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 11.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;methane;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methane;2-methylpropane?
The IUPAC name of ethane;methane;2-methylpropane (CID 161431647) is ethane;methane;2-methylpropane.
What is the SMILES notation for ethane;methane;2-methylpropane?
The canonical SMILES for ethane;methane;2-methylpropane is C.CC.CC.CC.CC.CC.CC.CC.CC.CC.CC(C)C.
What is the InChIKey of ethane;methane;2-methylpropane?
The InChIKey is VYCAXOYUYIYSDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10.9C2H6.CH4/c1-4(2)3;9*1-2;/h4H,1-3H3;9*1-2H3;1H4.
What are the key properties of ethane;methane;2-methylpropane?
ethane;methane;2-methylpropane has a molecular weight of 344.80 g/mol, XLogP of 11.53, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methane;2-methylpropane is sourced from PubChem (CID 161431647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).