About 2,3-dimethylbutane;methanol
2,3-dimethylbutane;methanol (PubChem CID 142260145) has the molecular formula C7H18O
and a molecular weight of 118.22 g/mol. Its IUPAC name is 2,3-dimethylbutane;methanol.
Molecular Properties
| Compound Name | 2,3-dimethylbutane;methanol |
| PubChem CID | 142260145 |
| Molecular Formula | C7H18O |
| Molecular Weight | 118.22 g/mol |
| Exact Mass | 118.14 |
| IUPAC Name | 2,3-dimethylbutane;methanol |
| SMILES | CC(C)C(C)C.CO |
| InChI | InChI=1S/C6H14.CH4O/c1-5(2)6(3)4;1-2/h5-6H,1-4H3;2H,1H3 |
| InChIKey | HMAWFFNGGHJPIO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.22 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3-dimethylbutane;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylbutane;methanol?
The IUPAC name of 2,3-dimethylbutane;methanol (CID 142260145) is 2,3-dimethylbutane;methanol.
What is the SMILES notation for 2,3-dimethylbutane;methanol?
The canonical SMILES for 2,3-dimethylbutane;methanol is CC(C)C(C)C.CO.
What is the InChIKey of 2,3-dimethylbutane;methanol?
The InChIKey is HMAWFFNGGHJPIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14.CH4O/c1-5(2)6(3)4;1-2/h5-6H,1-4H3;2H,1H3.
What are the key properties of 2,3-dimethylbutane;methanol?
2,3-dimethylbutane;methanol has a molecular weight of 118.22 g/mol, XLogP of 1.91, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylbutane;methanol is sourced from PubChem (CID 142260145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).