About 2,3-dimethylbutane;ethane;propane
2,3-dimethylbutane;ethane;propane (PubChem CID 144519619) has the molecular formula C17H46
and a molecular weight of 250.55 g/mol. Its IUPAC name is 2,3-dimethylbutane;ethane;propane.
Molecular Properties
| Compound Name | 2,3-dimethylbutane;ethane;propane |
| PubChem CID | 144519619 |
| Molecular Formula | C17H46 |
| Molecular Weight | 250.55 g/mol |
| Exact Mass | 250.36 |
| IUPAC Name | 2,3-dimethylbutane;ethane;propane |
| SMILES | CC.CC.CC.CC.CC(C)C(C)C.CCC |
| InChI | InChI=1S/C6H14.C3H8.4C2H6/c1-5(2)6(3)4;1-3-2;4*1-2/h5-6H,1-4H3;3H2,1-2H3;4*1-2H3 |
| InChIKey | ZMXSASOTKKDIMP-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 250.55 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,3-dimethylbutane;ethane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylbutane;ethane;propane?
The IUPAC name of 2,3-dimethylbutane;ethane;propane (CID 144519619) is 2,3-dimethylbutane;ethane;propane.
What is the SMILES notation for 2,3-dimethylbutane;ethane;propane?
The canonical SMILES for 2,3-dimethylbutane;ethane;propane is CC.CC.CC.CC.CC(C)C(C)C.CCC.
What is the InChIKey of 2,3-dimethylbutane;ethane;propane?
The InChIKey is ZMXSASOTKKDIMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14.C3H8.4C2H6/c1-5(2)6(3)4;1-3-2;4*1-2/h5-6H,1-4H3;3H2,1-2H3;4*1-2H3.
What are the key properties of 2,3-dimethylbutane;ethane;propane?
2,3-dimethylbutane;ethane;propane has a molecular weight of 250.55 g/mol, XLogP of 7.82, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylbutane;ethane;propane is sourced from PubChem (CID 144519619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).