About 2,3-dimethylbutane;ethanamine
2,3-dimethylbutane;ethanamine (PubChem CID 130404430) has the molecular formula C8H21N
and a molecular weight of 131.26 g/mol. Its IUPAC name is 2,3-dimethylbutane;ethanamine.
Molecular Properties
| Compound Name | 2,3-dimethylbutane;ethanamine |
| PubChem CID | 130404430 |
| Molecular Formula | C8H21N |
| Molecular Weight | 131.26 g/mol |
| Exact Mass | 131.17 |
| IUPAC Name | 2,3-dimethylbutane;ethanamine |
| SMILES | CC(C)C(C)C.CCN |
| InChI | InChI=1S/C6H14.C2H7N/c1-5(2)6(3)4;1-2-3/h5-6H,1-4H3;2-3H2,1H3 |
| InChIKey | QDRKOGWGGQVKFV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.26 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3-dimethylbutane;ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylbutane;ethanamine?
The IUPAC name of 2,3-dimethylbutane;ethanamine (CID 130404430) is 2,3-dimethylbutane;ethanamine.
What is the SMILES notation for 2,3-dimethylbutane;ethanamine?
The canonical SMILES for 2,3-dimethylbutane;ethanamine is CC(C)C(C)C.CCN.
What is the InChIKey of 2,3-dimethylbutane;ethanamine?
The InChIKey is QDRKOGWGGQVKFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14.C2H7N/c1-5(2)6(3)4;1-2-3/h5-6H,1-4H3;2-3H2,1H3.
What are the key properties of 2,3-dimethylbutane;ethanamine?
2,3-dimethylbutane;ethanamine has a molecular weight of 131.26 g/mol, XLogP of 2.26, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylbutane;ethanamine is sourced from PubChem (CID 130404430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).