About ethanamine;2-methylpentane
ethanamine;2-methylpentane (PubChem CID 143240474) has the molecular formula C8H21N
and a molecular weight of 131.26 g/mol. Its IUPAC name is ethanamine;2-methylpentane.
Molecular Properties
| Compound Name | ethanamine;2-methylpentane |
| PubChem CID | 143240474 |
| Molecular Formula | C8H21N |
| Molecular Weight | 131.26 g/mol |
| Exact Mass | 131.17 |
| IUPAC Name | ethanamine;2-methylpentane |
| SMILES | CCCC(C)C.CCN |
| InChI | InChI=1S/C6H14.C2H7N/c1-4-5-6(2)3;1-2-3/h6H,4-5H2,1-3H3;2-3H2,1H3 |
| InChIKey | FJYOOAFHGAFFBS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.26 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethanamine;2-methylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanamine;2-methylpentane?
The IUPAC name of ethanamine;2-methylpentane (CID 143240474) is ethanamine;2-methylpentane.
What is the SMILES notation for ethanamine;2-methylpentane?
The canonical SMILES for ethanamine;2-methylpentane is CCCC(C)C.CCN.
What is the InChIKey of ethanamine;2-methylpentane?
The InChIKey is FJYOOAFHGAFFBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14.C2H7N/c1-4-5-6(2)3;1-2-3/h6H,4-5H2,1-3H3;2-3H2,1H3.
What are the key properties of ethanamine;2-methylpentane?
ethanamine;2-methylpentane has a molecular weight of 131.26 g/mol, XLogP of 2.41, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethanamine;2-methylpentane is sourced from PubChem (CID 143240474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).