About 2-methylpentane diisocyanate
2-methylpentane diisocyanate (PubChem CID 22323257) has the molecular formula C8H14N2O2-2
and a molecular weight of 170.21 g/mol. Its IUPAC name is 2-methylpentane diisocyanate.
Molecular Properties
| Compound Name | 2-methylpentane diisocyanate |
| PubChem CID | 22323257 |
| Molecular Formula | C8H14N2O2-2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 2-methylpentane diisocyanate |
| SMILES | CCCC(C)C.[N-]=C=O.[N-]=C=O |
| InChI | InChI=1S/C6H14.2CNO/c1-4-5-6(2)3;2*2-1-3/h6H,4-5H2,1-3H3;;/q;2*-1 |
| InChIKey | SXBIOUJFZCKSND-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 78.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpentane diisocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpentane diisocyanate?
The IUPAC name of 2-methylpentane diisocyanate (CID 22323257) is 2-methylpentane diisocyanate.
What is the SMILES notation for 2-methylpentane diisocyanate?
The canonical SMILES for 2-methylpentane diisocyanate is CCCC(C)C.[N-]=C=O.[N-]=C=O.
What is the InChIKey of 2-methylpentane diisocyanate?
The InChIKey is SXBIOUJFZCKSND-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14.2CNO/c1-4-5-6(2)3;2*2-1-3/h6H,4-5H2,1-3H3;;/q;2*-1.
What are the key properties of 2-methylpentane diisocyanate?
2-methylpentane diisocyanate has a molecular weight of 170.21 g/mol, XLogP of 2.23, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpentane diisocyanate is sourced from PubChem (CID 22323257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).