About ethane;2-methylpentane;prop-1-yne
ethane;2-methylpentane;prop-1-yne (PubChem CID 143374502) has the molecular formula C15H36
and a molecular weight of 216.45 g/mol. Its IUPAC name is ethane;2-methylpentane;prop-1-yne.
Molecular Properties
| Compound Name | ethane;2-methylpentane;prop-1-yne |
| PubChem CID | 143374502 |
| Molecular Formula | C15H36 |
| Molecular Weight | 216.45 g/mol |
| Exact Mass | 216.28 |
| IUPAC Name | ethane;2-methylpentane;prop-1-yne |
| SMILES | C#CC.CC.CC.CC.CCCC(C)C |
| InChI | InChI=1S/C6H14.C3H4.3C2H6/c1-4-5-6(2)3;1-3-2;3*1-2/h6H,4-5H2,1-3H3;1H,2H3;3*1-2H3 |
| InChIKey | UXNQNCAKQHQTCZ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 216.45 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-methylpentane;prop-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylpentane;prop-1-yne?
The IUPAC name of ethane;2-methylpentane;prop-1-yne (CID 143374502) is ethane;2-methylpentane;prop-1-yne.
What is the SMILES notation for ethane;2-methylpentane;prop-1-yne?
The canonical SMILES for ethane;2-methylpentane;prop-1-yne is C#CC.CC.CC.CC.CCCC(C)C.
What is the InChIKey of ethane;2-methylpentane;prop-1-yne?
The InChIKey is UXNQNCAKQHQTCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14.C3H4.3C2H6/c1-4-5-6(2)3;1-3-2;3*1-2/h6H,4-5H2,1-3H3;1H,2H3;3*1-2H3.
What are the key properties of ethane;2-methylpentane;prop-1-yne?
ethane;2-methylpentane;prop-1-yne has a molecular weight of 216.45 g/mol, XLogP of 6.16, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylpentane;prop-1-yne is sourced from PubChem (CID 143374502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).