About 2-methylpentane;titanium(4+);tetrachloride
2-methylpentane;titanium(4+);tetrachloride (PubChem CID 158147790) has the molecular formula C6H14Cl4Ti
and a molecular weight of 275.86 g/mol. Its IUPAC name is 2-methylpentane;titanium(4+);tetrachloride.
Molecular Properties
| Compound Name | 2-methylpentane;titanium(4+);tetrachloride |
| PubChem CID | 158147790 |
| Molecular Formula | C6H14Cl4Ti |
| Molecular Weight | 275.86 g/mol |
| Exact Mass | 273.93 |
| IUPAC Name | 2-methylpentane;titanium(4+);tetrachloride |
| SMILES | CCCC(C)C.[Cl-].[Cl-].[Cl-].[Cl-].[Ti+4] |
| InChI | InChI=1S/C6H14.4ClH.Ti/c1-4-5-6(2)3;;;;;/h6H,4-5H2,1-3H3;4*1H;/q;;;;;+4/p-4 |
| InChIKey | FUSNVJPPLSNCJQ-UHFFFAOYSA-J |
| XLogP | -9.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.86 |
| LogP ≤ 5 | -9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-methylpentane;titanium(4+);tetrachloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpentane;titanium(4+);tetrachloride?
The IUPAC name of 2-methylpentane;titanium(4+);tetrachloride (CID 158147790) is 2-methylpentane;titanium(4+);tetrachloride.
What is the SMILES notation for 2-methylpentane;titanium(4+);tetrachloride?
The canonical SMILES for 2-methylpentane;titanium(4+);tetrachloride is CCCC(C)C.[Cl-].[Cl-].[Cl-].[Cl-].[Ti+4].
What is the InChIKey of 2-methylpentane;titanium(4+);tetrachloride?
The InChIKey is FUSNVJPPLSNCJQ-UHFFFAOYSA-J. The full InChI is InChI=1S/C6H14.4ClH.Ti/c1-4-5-6(2)3;;;;;/h6H,4-5H2,1-3H3;4*1H;/q;;;;;+4/p-4.
What are the key properties of 2-methylpentane;titanium(4+);tetrachloride?
2-methylpentane;titanium(4+);tetrachloride has a molecular weight of 275.86 g/mol, XLogP of -9.54, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpentane;titanium(4+);tetrachloride is sourced from PubChem (CID 158147790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).