About ethane;2-methylpropane;propane
ethane;2-methylpropane;propane (PubChem CID 144940074) has the molecular formula C14H38
and a molecular weight of 206.46 g/mol. Its IUPAC name is ethane;2-methylpropane;propane.
Molecular Properties
| Compound Name | ethane;2-methylpropane;propane |
| PubChem CID | 144940074 |
| Molecular Formula | C14H38 |
| Molecular Weight | 206.46 g/mol |
| Exact Mass | 206.30 |
| IUPAC Name | ethane;2-methylpropane;propane |
| SMILES | CC.CC.CC(C)C.CCC.CCC |
| InChI | InChI=1S/C4H10.2C3H8.2C2H6/c1-4(2)3;2*1-3-2;2*1-2/h4H,1-3H3;2*3H2,1-2H3;2*1-2H3 |
| InChIKey | NDTRCESJZHBFKY-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 206.46 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;2-methylpropane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylpropane;propane?
The IUPAC name of ethane;2-methylpropane;propane (CID 144940074) is ethane;2-methylpropane;propane.
What is the SMILES notation for ethane;2-methylpropane;propane?
The canonical SMILES for ethane;2-methylpropane;propane is CC.CC.CC(C)C.CCC.CCC.
What is the InChIKey of ethane;2-methylpropane;propane?
The InChIKey is NDTRCESJZHBFKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10.2C3H8.2C2H6/c1-4(2)3;2*1-3-2;2*1-2/h4H,1-3H3;2*3H2,1-2H3;2*1-2H3.
What are the key properties of ethane;2-methylpropane;propane?
ethane;2-methylpropane;propane has a molecular weight of 206.46 g/mol, XLogP of 6.55, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylpropane;propane is sourced from PubChem (CID 144940074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).