C18H38 — CID 158413804
2,3-dimethylbutane;bis(2,3-dimethylbut-1-ene) (PubChem CID 158413804) has the molecular formula C18H38 and a molecular weight of 254.50 g/mol. Its IUPAC name is 2,3-dimethylbutane;bis(2,3-dimethylbut-1-ene).
| Compound Name | 2,3-dimethylbutane;bis(2,3-dimethylbut-1-ene) |
|---|---|
| PubChem CID | 158413804 |
| Molecular Formula | C18H38 |
| Molecular Weight | 254.50 g/mol |
| Exact Mass | 254.30 |
| IUPAC Name | 2,3-dimethylbutane;bis(2,3-dimethylbut-1-ene) |
| SMILES | C=C(C)C(C)C.C=C(C)C(C)C.CC(C)C(C)C |
| InChI | InChI=1S/C6H14.2C6H12/c3*1-5(2)6(3)4/h5-6H,1-4H3;2*6H,1H2,2-4H3 |
| InChIKey | GZQCIFKQYBLQSA-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.50 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|