C16H29B — CID 174076826
(2,5-dimethyl-4-prop-1-en-2-ylhex-5-en-3-yl)-(3-methylbutan-2-ylidene)borane (PubChem CID 174076826) has the molecular formula C16H29B and a molecular weight of 232.22 g/mol. Its IUPAC name is (2,5-dimethyl-4-prop-1-en-2-ylhex-5-en-3-yl)-(3-methylbutan-2-ylidene)borane.
| Compound Name | (2,5-dimethyl-4-prop-1-en-2-ylhex-5-en-3-yl)-(3-methylbutan-2-ylidene)borane |
|---|---|
| PubChem CID | 174076826 |
| Molecular Formula | C16H29B |
| Molecular Weight | 232.22 g/mol |
| Exact Mass | 232.24 |
| IUPAC Name | (2,5-dimethyl-4-prop-1-en-2-ylhex-5-en-3-yl)-(3-methylbutan-2-ylidene)borane |
| SMILES | C=C(C)C(C(=C)C)C(/B=C(\C)C(C)C)C(C)C |
| InChI | InChI=1S/C16H29B/c1-10(2)14(9)17-16(13(7)8)15(11(3)4)12(5)6/h10,13,15-16H,3,5H2,1-2,4,6-9H3 |
| InChIKey | MPFRWADAABRYIU-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.22 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|