C8H15Cl — CID 169183451
3-(chloromethyl)-2,4-dimethylpent-1-ene (PubChem CID 169183451) has the molecular formula C8H15Cl and a molecular weight of 146.66 g/mol. Its IUPAC name is 3-(chloromethyl)-2,4-dimethylpent-1-ene.
| Compound Name | 3-(chloromethyl)-2,4-dimethylpent-1-ene |
|---|---|
| PubChem CID | 169183451 |
| Molecular Formula | C8H15Cl |
| Molecular Weight | 146.66 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | 3-(chloromethyl)-2,4-dimethylpent-1-ene |
| SMILES | C=C(C)C(CCl)C(C)C |
| InChI | InChI=1S/C8H15Cl/c1-6(2)8(5-9)7(3)4/h7-8H,1,5H2,2-4H3 |
| InChIKey | AKSJLNOUDRSHJD-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.66 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|