C14H26 — CID 102247681
(5E)-2,5,7-trimethyl-3-propan-2-ylocta-1,5-diene (PubChem CID 102247681) has the molecular formula C14H26 and a molecular weight of 194.36 g/mol. Its IUPAC name is (5E)-2,5,7-trimethyl-3-propan-2-ylocta-1,5-diene.
| Compound Name | (5E)-2,5,7-trimethyl-3-propan-2-ylocta-1,5-diene |
|---|---|
| PubChem CID | 102247681 |
| Molecular Formula | C14H26 |
| Molecular Weight | 194.36 g/mol |
| Exact Mass | 194.20 |
| IUPAC Name | (5E)-2,5,7-trimethyl-3-propan-2-ylocta-1,5-diene |
| SMILES | C=C(C)C(C/C(C)=C/C(C)C)C(C)C |
| InChI | InChI=1S/C14H26/c1-10(2)8-13(7)9-14(11(3)4)12(5)6/h8,10,12,14H,3,9H2,1-2,4-7H3/b13-8+ |
| InChIKey | YKWTVQSOKZGCJC-MDWZMJQESA-N |
| XLogP | 4.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.36 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|