C13H22 — CID 91102055
2,3,6-trimethyl-4-prop-1-en-2-ylhepta-1,6-diene (PubChem CID 91102055) has the molecular formula C13H22 and a molecular weight of 178.32 g/mol. Its IUPAC name is 2,3,6-trimethyl-4-prop-1-en-2-ylhepta-1,6-diene.
| Compound Name | 2,3,6-trimethyl-4-prop-1-en-2-ylhepta-1,6-diene |
|---|---|
| PubChem CID | 91102055 |
| Molecular Formula | C13H22 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.17 |
| IUPAC Name | 2,3,6-trimethyl-4-prop-1-en-2-ylhepta-1,6-diene |
| SMILES | C=C(C)CC(C(=C)C)C(C)C(=C)C |
| InChI | InChI=1S/C13H22/c1-9(2)8-13(11(5)6)12(7)10(3)4/h12-13H,1,3,5,8H2,2,4,6-7H3 |
| InChIKey | VBBZYZQONHHCCW-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|