C8H14O — CID 45085211
(3S)-3,5-dimethylhex-5-en-2-one (PubChem CID 45085211) has the molecular formula C8H14O and a molecular weight of 126.20 g/mol. Its IUPAC name is (3S)-3,5-dimethylhex-5-en-2-one.
| Compound Name | (3S)-3,5-dimethylhex-5-en-2-one |
|---|---|
| PubChem CID | 45085211 |
| Molecular Formula | C8H14O |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | (3S)-3,5-dimethylhex-5-en-2-one |
| SMILES | C=C(C)C[C@H](C)C(C)=O |
| InChI | InChI=1S/C8H14O/c1-6(2)5-7(3)8(4)9/h7H,1,5H2,2-4H3/t7-/m0/s1 |
| InChIKey | NSAZVQBDLMVTOQ-ZETCQYMHSA-N |
| XLogP | 2.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|