C8H13ClO — CID 106439161
6-chloro-3,5-dimethylhex-5-en-2-one (PubChem CID 106439161) has the molecular formula C8H13ClO and a molecular weight of 160.64 g/mol. Its IUPAC name is 6-chloro-3,5-dimethylhex-5-en-2-one.
| Compound Name | 6-chloro-3,5-dimethylhex-5-en-2-one |
|---|---|
| PubChem CID | 106439161 |
| Molecular Formula | C8H13ClO |
| Molecular Weight | 160.64 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 6-chloro-3,5-dimethylhex-5-en-2-one |
| SMILES | CC(=O)C(C)CC(C)=CCl |
| InChI | InChI=1S/C8H13ClO/c1-6(5-9)4-7(2)8(3)10/h5,7H,4H2,1-3H3 |
| InChIKey | MBHALUIAZRQHBL-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.64 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |