C11H20ClNO2 — CID 106437639
methyl 2-[(3-chloro-2-methylprop-2-enyl)amino]-4-methylpentanoate (PubChem CID 106437639) has the molecular formula C11H20ClNO2 and a molecular weight of 233.74 g/mol. Its IUPAC name is methyl 2-[(3-chloro-2-methylprop-2-enyl)amino]-4-methylpentanoate.
| Compound Name | methyl 2-[(3-chloro-2-methylprop-2-enyl)amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 106437639 |
| Molecular Formula | C11H20ClNO2 |
| Molecular Weight | 233.74 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | methyl 2-[(3-chloro-2-methylprop-2-enyl)amino]-4-methylpentanoate |
| SMILES | COC(=O)C(CC(C)C)NCC(C)=CCl |
| InChI | InChI=1S/C11H20ClNO2/c1-8(2)5-10(11(14)15-4)13-7-9(3)6-12/h6,8,10,13H,5,7H2,1-4H3 |
| InChIKey | DHXUTRSRWFKRGD-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.74 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |