C13H27NO3 — CID 103033254
methyl 2-[(3-methoxy-3-methylbutyl)amino]-4-methylpentanoate (PubChem CID 103033254) has the molecular formula C13H27NO3 and a molecular weight of 245.36 g/mol. Its IUPAC name is methyl 2-[(3-methoxy-3-methylbutyl)amino]-4-methylpentanoate.
| Compound Name | methyl 2-[(3-methoxy-3-methylbutyl)amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 103033254 |
| Molecular Formula | C13H27NO3 |
| Molecular Weight | 245.36 g/mol |
| Exact Mass | 245.20 |
| IUPAC Name | methyl 2-[(3-methoxy-3-methylbutyl)amino]-4-methylpentanoate |
| SMILES | COC(=O)C(CC(C)C)NCCC(C)(C)OC |
| InChI | InChI=1S/C13H27NO3/c1-10(2)9-11(12(15)16-5)14-8-7-13(3,4)17-6/h10-11,14H,7-9H2,1-6H3 |
| InChIKey | LFRKXTVLSIPTCA-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.36 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |