About 4-methyl-2,5-dioxohexanal
4-methyl-2,5-dioxohexanal (PubChem CID 23590125) has the molecular formula C7H10O3
and a molecular weight of 142.15 g/mol. Its IUPAC name is 4-methyl-2,5-dioxohexanal.
Molecular Properties
| Compound Name | 4-methyl-2,5-dioxohexanal |
| PubChem CID | 23590125 |
| Molecular Formula | C7H10O3 |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | 4-methyl-2,5-dioxohexanal |
| SMILES | CC(=O)C(C)CC(=O)C=O |
| InChI | InChI=1S/C7H10O3/c1-5(6(2)9)3-7(10)4-8/h4-5H,3H2,1-2H3 |
| InChIKey | OQVWZUJTEJWTRL-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-2,5-dioxohexanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2,5-dioxohexanal?
The IUPAC name of 4-methyl-2,5-dioxohexanal (CID 23590125) is 4-methyl-2,5-dioxohexanal.
What is the SMILES notation for 4-methyl-2,5-dioxohexanal?
The canonical SMILES for 4-methyl-2,5-dioxohexanal is CC(=O)C(C)CC(=O)C=O.
What is the InChIKey of 4-methyl-2,5-dioxohexanal?
The InChIKey is OQVWZUJTEJWTRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O3/c1-5(6(2)9)3-7(10)4-8/h4-5H,3H2,1-2H3.
What are the key properties of 4-methyl-2,5-dioxohexanal?
4-methyl-2,5-dioxohexanal has a molecular weight of 142.15 g/mol, XLogP of 0.37, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2,5-dioxohexanal is sourced from PubChem (CID 23590125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).