About 5-hydroxy-2-oxohexanal
5-hydroxy-2-oxohexanal (PubChem CID 54288089) has the molecular formula C6H10O3
and a molecular weight of 130.14 g/mol. Its IUPAC name is 5-hydroxy-2-oxohexanal.
Molecular Properties
| Compound Name | 5-hydroxy-2-oxohexanal |
| PubChem CID | 54288089 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.14 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | 5-hydroxy-2-oxohexanal |
| SMILES | CC(O)CCC(=O)C=O |
| InChI | InChI=1S/C6H10O3/c1-5(8)2-3-6(9)4-7/h4-5,8H,2-3H2,1H3 |
| InChIKey | RVOVPSYFTJDKHE-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.14 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxy-2-oxohexanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-2-oxohexanal?
The IUPAC name of 5-hydroxy-2-oxohexanal (CID 54288089) is 5-hydroxy-2-oxohexanal.
What is the SMILES notation for 5-hydroxy-2-oxohexanal?
The canonical SMILES for 5-hydroxy-2-oxohexanal is CC(O)CCC(=O)C=O.
What is the InChIKey of 5-hydroxy-2-oxohexanal?
The InChIKey is RVOVPSYFTJDKHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3/c1-5(8)2-3-6(9)4-7/h4-5,8H,2-3H2,1H3.
What are the key properties of 5-hydroxy-2-oxohexanal?
5-hydroxy-2-oxohexanal has a molecular weight of 130.14 g/mol, XLogP of -0.08, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-2-oxohexanal is sourced from PubChem (CID 54288089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).