C9H15NO3 — CID 135189786
(6S)-6-(methylamino)-2,7-dioxooctanal (PubChem CID 135189786) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is (6S)-6-(methylamino)-2,7-dioxooctanal.
| Compound Name | (6S)-6-(methylamino)-2,7-dioxooctanal |
|---|---|
| PubChem CID | 135189786 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | (6S)-6-(methylamino)-2,7-dioxooctanal |
| SMILES | CN[C@@H](CCCC(=O)C=O)C(C)=O |
| InChI | InChI=1S/C9H15NO3/c1-7(12)9(10-2)5-3-4-8(13)6-11/h6,9-10H,3-5H2,1-2H3/t9-/m0/s1 |
| InChIKey | DTGFPWUTDPLHDK-VIFPVBQESA-N |
| XLogP | 0.10 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|