C9H16ClNO2 — CID 106439197
2-[(3-chloro-2-methylprop-2-enyl)amino]-3-methylbutanoic acid (PubChem CID 106439197) has the molecular formula C9H16ClNO2 and a molecular weight of 205.68 g/mol. Its IUPAC name is 2-[(3-chloro-2-methylprop-2-enyl)amino]-3-methylbutanoic acid.
| Compound Name | 2-[(3-chloro-2-methylprop-2-enyl)amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 106439197 |
| Molecular Formula | C9H16ClNO2 |
| Molecular Weight | 205.68 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 2-[(3-chloro-2-methylprop-2-enyl)amino]-3-methylbutanoic acid |
| SMILES | CC(=CCl)CNC(C(=O)O)C(C)C |
| InChI | InChI=1S/C9H16ClNO2/c1-6(2)8(9(12)13)11-5-7(3)4-10/h4,6,8,11H,5H2,1-3H3,(H,12,13) |
| InChIKey | DOQAQQVUBXDFBY-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.68 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |