C7H13BrClN — CID 106440126
N-(1-bromopropan-2-yl)-3-chloro-2-methylprop-2-en-1-amine (PubChem CID 106440126) has the molecular formula C7H13BrClN and a molecular weight of 226.54 g/mol. Its IUPAC name is N-(1-bromopropan-2-yl)-3-chloro-2-methylprop-2-en-1-amine.
| Compound Name | N-(1-bromopropan-2-yl)-3-chloro-2-methylprop-2-en-1-amine |
|---|---|
| PubChem CID | 106440126 |
| Molecular Formula | C7H13BrClN |
| Molecular Weight | 226.54 g/mol |
| Exact Mass | 224.99 |
| IUPAC Name | N-(1-bromopropan-2-yl)-3-chloro-2-methylprop-2-en-1-amine |
| SMILES | CC(=CCl)CNC(C)CBr |
| InChI | InChI=1S/C7H13BrClN/c1-6(4-9)5-10-7(2)3-8/h4,7,10H,3,5H2,1-2H3 |
| InChIKey | GTIWCCCQMHXFIL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.54 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|