C8H15ClN2O — CID 106437577
2-[(3-chloro-2-methylprop-2-enyl)amino]-N-methylpropanamide (PubChem CID 106437577) has the molecular formula C8H15ClN2O and a molecular weight of 190.67 g/mol. Its IUPAC name is 2-[(3-chloro-2-methylprop-2-enyl)amino]-N-methylpropanamide.
| Compound Name | 2-[(3-chloro-2-methylprop-2-enyl)amino]-N-methylpropanamide |
|---|---|
| PubChem CID | 106437577 |
| Molecular Formula | C8H15ClN2O |
| Molecular Weight | 190.67 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | 2-[(3-chloro-2-methylprop-2-enyl)amino]-N-methylpropanamide |
| SMILES | CNC(=O)C(C)NCC(C)=CCl |
| InChI | InChI=1S/C8H15ClN2O/c1-6(4-9)5-11-7(2)8(12)10-3/h4,7,11H,5H2,1-3H3,(H,10,12) |
| InChIKey | JBNFAOALCWQGKE-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.67 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |