C7H14ClNO — CID 106437749
2-[(3-chloro-2-methylprop-2-enyl)amino]propan-1-ol (PubChem CID 106437749) has the molecular formula C7H14ClNO and a molecular weight of 163.65 g/mol. Its IUPAC name is 2-[(3-chloro-2-methylprop-2-enyl)amino]propan-1-ol.
| Compound Name | 2-[(3-chloro-2-methylprop-2-enyl)amino]propan-1-ol |
|---|---|
| PubChem CID | 106437749 |
| Molecular Formula | C7H14ClNO |
| Molecular Weight | 163.65 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | 2-[(3-chloro-2-methylprop-2-enyl)amino]propan-1-ol |
| SMILES | CC(=CCl)CNC(C)CO |
| InChI | InChI=1S/C7H14ClNO/c1-6(3-8)4-9-7(2)5-10/h3,7,9-10H,4-5H2,1-2H3 |
| InChIKey | SSQWBYQYPGHAPE-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.65 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |