C9H18ClNS — CID 106438115
N-(3-chloro-2-methylprop-2-enyl)-1-methylsulfanylbutan-2-amine (PubChem CID 106438115) has the molecular formula C9H18ClNS and a molecular weight of 207.77 g/mol. Its IUPAC name is N-(3-chloro-2-methylprop-2-enyl)-1-methylsulfanylbutan-2-amine.
| Compound Name | N-(3-chloro-2-methylprop-2-enyl)-1-methylsulfanylbutan-2-amine |
|---|---|
| PubChem CID | 106438115 |
| Molecular Formula | C9H18ClNS |
| Molecular Weight | 207.77 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | N-(3-chloro-2-methylprop-2-enyl)-1-methylsulfanylbutan-2-amine |
| SMILES | CCC(CSC)NCC(C)=CCl |
| InChI | InChI=1S/C9H18ClNS/c1-4-9(7-12-3)11-6-8(2)5-10/h5,9,11H,4,6-7H2,1-3H3 |
| InChIKey | ROPWVBDMFNHBJR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.77 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |