C11H21NO2S — CID 103268348
methyl (Z)-2-methyl-4-(1-methylsulfanylbutan-2-ylamino)but-2-enoate (PubChem CID 103268348) has the molecular formula C11H21NO2S and a molecular weight of 231.36 g/mol. Its IUPAC name is methyl (Z)-2-methyl-4-(1-methylsulfanylbutan-2-ylamino)but-2-enoate.
| Compound Name | methyl (Z)-2-methyl-4-(1-methylsulfanylbutan-2-ylamino)but-2-enoate |
|---|---|
| PubChem CID | 103268348 |
| Molecular Formula | C11H21NO2S |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | methyl (Z)-2-methyl-4-(1-methylsulfanylbutan-2-ylamino)but-2-enoate |
| SMILES | CCC(CSC)NC/C=C(/C)C(=O)OC |
| InChI | InChI=1S/C11H21NO2S/c1-5-10(8-15-4)12-7-6-9(2)11(13)14-3/h6,10,12H,5,7-8H2,1-4H3/b9-6- |
| InChIKey | MFXDPLMWZNSPKC-TWGQIWQCSA-N |
| XLogP | 1.84 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|