C14H27NO2 — CID 103247233
methyl 2-methyl-4-(6-methylheptan-2-ylamino)but-2-enoate (PubChem CID 103247233) has the molecular formula C14H27NO2 and a molecular weight of 241.37 g/mol. Its IUPAC name is methyl 2-methyl-4-(6-methylheptan-2-ylamino)but-2-enoate.
| Compound Name | methyl 2-methyl-4-(6-methylheptan-2-ylamino)but-2-enoate |
|---|---|
| PubChem CID | 103247233 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | methyl 2-methyl-4-(6-methylheptan-2-ylamino)but-2-enoate |
| SMILES | COC(=O)C(C)=CCNC(C)CCCC(C)C |
| InChI | InChI=1S/C14H27NO2/c1-11(2)7-6-8-13(4)15-10-9-12(3)14(16)17-5/h9,11,13,15H,6-8,10H2,1-5H3 |
| InChIKey | LCGZJAXCTNVUGZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|