C12H23NO3S — CID 103267831
methyl 2-ethyl-4-(4-methylsulfinylbutan-2-ylamino)but-2-enoate (PubChem CID 103267831) has the molecular formula C12H23NO3S and a molecular weight of 261.39 g/mol. Its IUPAC name is methyl 2-ethyl-4-(4-methylsulfinylbutan-2-ylamino)but-2-enoate.
| Compound Name | methyl 2-ethyl-4-(4-methylsulfinylbutan-2-ylamino)but-2-enoate |
|---|---|
| PubChem CID | 103267831 |
| Molecular Formula | C12H23NO3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | methyl 2-ethyl-4-(4-methylsulfinylbutan-2-ylamino)but-2-enoate |
| SMILES | CCC(=CCNC(C)CCS(C)=O)C(=O)OC |
| InChI | InChI=1S/C12H23NO3S/c1-5-11(12(14)16-3)6-8-13-10(2)7-9-17(4)15/h6,10,13H,5,7-9H2,1-4H3 |
| InChIKey | IIDONEWVGIVCHW-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|