C12H19NO2 — CID 106231869
methyl (Z)-2-ethyl-4-(pent-1-yn-3-ylamino)but-2-enoate (PubChem CID 106231869) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is methyl (Z)-2-ethyl-4-(pent-1-yn-3-ylamino)but-2-enoate.
| Compound Name | methyl (Z)-2-ethyl-4-(pent-1-yn-3-ylamino)but-2-enoate |
|---|---|
| PubChem CID | 106231869 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | methyl (Z)-2-ethyl-4-(pent-1-yn-3-ylamino)but-2-enoate |
| SMILES | C#CC(CC)NC/C=C(/CC)C(=O)OC |
| InChI | InChI=1S/C12H19NO2/c1-5-10(12(14)15-4)8-9-13-11(6-2)7-3/h2,8,11,13H,5,7,9H2,1,3-4H3/b10-8- |
| InChIKey | RQTQSCAUSKAIMQ-NTMALXAHSA-N |
| XLogP | 1.50 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|