C13H21NO2 — CID 106231927
methyl (Z)-2-ethyl-4-(hex-1-yn-3-ylamino)but-2-enoate (PubChem CID 106231927) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is methyl (Z)-2-ethyl-4-(hex-1-yn-3-ylamino)but-2-enoate.
| Compound Name | methyl (Z)-2-ethyl-4-(hex-1-yn-3-ylamino)but-2-enoate |
|---|---|
| PubChem CID | 106231927 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | methyl (Z)-2-ethyl-4-(hex-1-yn-3-ylamino)but-2-enoate |
| SMILES | C#CC(CCC)NC/C=C(/CC)C(=O)OC |
| InChI | InChI=1S/C13H21NO2/c1-5-8-12(7-3)14-10-9-11(6-2)13(15)16-4/h3,9,12,14H,5-6,8,10H2,1-2,4H3/b11-9- |
| InChIKey | VDHVLJNKKRABIX-LUAWRHEFSA-N |
| XLogP | 1.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|