C13H19NO3 — CID 103242394
methyl (E)-4-[1-(furan-2-yl)propan-2-ylamino]-2-methylbut-2-enoate (PubChem CID 103242394) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is methyl (E)-4-[1-(furan-2-yl)propan-2-ylamino]-2-methylbut-2-enoate.
| Compound Name | methyl (E)-4-[1-(furan-2-yl)propan-2-ylamino]-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 103242394 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | methyl (E)-4-[1-(furan-2-yl)propan-2-ylamino]-2-methylbut-2-enoate |
| SMILES | COC(=O)/C(C)=C/CNC(C)Cc1ccco1 |
| InChI | InChI=1S/C13H19NO3/c1-10(13(15)16-3)6-7-14-11(2)9-12-5-4-8-17-12/h4-6,8,11,14H,7,9H2,1-3H3/b10-6+ |
| InChIKey | IHKFGFOGSCABQG-UXBLZVDNSA-N |
| XLogP | 1.92 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|